C36H40N8O4 — CID 140876731
2-[(3R)-3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-4,4-dimethyl-5-(4-methylpiperazin-1-yl)-5-oxopent-2-enenitrile (PubChem CID 140876731) has the molecular formula C36H40N8O4 and a molecular weight of 648.77 g/mol. Its IUPAC name is 2-[(3R)-3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-4,4-dimethyl-5-(4-methylpiperazin-1-yl)-5-oxopent-2-enenitrile.
| Compound Name | 2-[(3R)-3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-4,4-dimethyl-5-(4-methylpiperazin-1-yl)-5-oxopent-2-enenitrile |
|---|---|
| PubChem CID | 140876731 |
| Molecular Formula | C36H40N8O4 |
| Molecular Weight | 648.77 g/mol |
| Exact Mass | 648.32 |
| IUPAC Name | 2-[(3R)-3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-4,4-dimethyl-5-(4-methylpiperazin-1-yl)-5-oxopent-2-enenitrile |
| SMILES | CN1CCN(C(=O)C(C)(C)C=C(C#N)C(=O)N2CCC[C@@H](n3c(=O)n(-c4ccc(Oc5ccccc5)cc4)c4c(N)nccc43)C2)CC1 |
| InChI | InChI=1S/C36H40N8O4/c1-36(2,34(46)41-20-18-40(3)19-21-41)22-25(23-37)33(45)42-17-7-8-27(24-42)43-30-15-16-39-32(38)31(30)44(35(43)47)26-11-13-29(14-12-26)48-28-9-5-4-6-10-28/h4-6,9-16,22,27H,7-8,17-21,24H2,1-3H3,(H2,38,39)/t27-/m1/s1 |
| InChIKey | PNHPKFKYHAXPQZ-HHHXNRCGSA-N |
| XLogP | 3.98 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.77 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|