C37H44N8O4 — CID 134586684
2-[3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-4-[4-(2-methoxyethyl)piperazin-1-yl]-4-methylpent-2-enenitrile (PubChem CID 134586684) has the molecular formula C37H44N8O4 and a molecular weight of 664.81 g/mol. Its IUPAC name is 2-[3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-4-[4-(2-methoxyethyl)piperazin-1-yl]-4-methylpent-2-enenitrile.
| Compound Name | 2-[3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-4-[4-(2-methoxyethyl)piperazin-1-yl]-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 134586684 |
| Molecular Formula | C37H44N8O4 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | 2-[3-[4-amino-2-oxo-3-(4-phenoxyphenyl)imidazo[4,5-c]pyridin-1-yl]piperidine-1-carbonyl]-4-[4-(2-methoxyethyl)piperazin-1-yl]-4-methylpent-2-enenitrile |
| SMILES | COCCN1CCN(C(C)(C)C=C(C#N)C(=O)N2CCCC(n3c(=O)n(-c4ccc(Oc5ccccc5)cc4)c4c(N)nccc43)C2)CC1 |
| InChI | InChI=1S/C37H44N8O4/c1-37(2,43-20-18-41(19-21-43)22-23-48-3)24-27(25-38)35(46)42-17-7-8-29(26-42)44-32-15-16-40-34(39)33(32)45(36(44)47)28-11-13-31(14-12-28)49-30-9-5-4-6-10-30/h4-6,9-16,24,29H,7-8,17-23,26H2,1-3H3,(H2,39,40) |
| InChIKey | YWWOJBKMVCCPPD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|