C28H30N6O3 — CID 126700274
4-amino-3-[4-[4-(dimethylamino)phenoxy]phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]imidazo[4,5-c]pyridin-2-one (PubChem CID 126700274) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 4-amino-3-[4-[4-(dimethylamino)phenoxy]phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]imidazo[4,5-c]pyridin-2-one.
| Compound Name | 4-amino-3-[4-[4-(dimethylamino)phenoxy]phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 126700274 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 4-amino-3-[4-[4-(dimethylamino)phenoxy]phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]imidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2c(=O)n(-c3ccc(Oc4ccc(N(C)C)cc4)cc3)c3c(N)nccc32)C1 |
| InChI | InChI=1S/C28H30N6O3/c1-4-25(35)32-17-5-6-21(18-32)33-24-15-16-30-27(29)26(24)34(28(33)36)20-9-13-23(14-10-20)37-22-11-7-19(8-12-22)31(2)3/h4,7-16,21H,1,5-6,17-18H2,2-3H3,(H2,29,30)/t21-/m1/s1 |
| InChIKey | ZZLMXYWMAISQTG-OAQYLSRUSA-N |
| XLogP | 3.98 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|