C18H20F3NO3S — CID 129034613
N-[(3R)-1-hydroxyhexan-3-yl]-4-(2,4,6-trifluorophenyl)benzenesulfonamide (PubChem CID 129034613) has the molecular formula C18H20F3NO3S and a molecular weight of 387.42 g/mol. Its IUPAC name is N-[(3R)-1-hydroxyhexan-3-yl]-4-(2,4,6-trifluorophenyl)benzenesulfonamide.
| Compound Name | N-[(3R)-1-hydroxyhexan-3-yl]-4-(2,4,6-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 129034613 |
| Molecular Formula | C18H20F3NO3S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[(3R)-1-hydroxyhexan-3-yl]-4-(2,4,6-trifluorophenyl)benzenesulfonamide |
| SMILES | CCC[C@H](CCO)NS(=O)(=O)c1ccc(-c2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H20F3NO3S/c1-2-3-14(8-9-23)22-26(24,25)15-6-4-12(5-7-15)18-16(20)10-13(19)11-17(18)21/h4-7,10-11,14,22-23H,2-3,8-9H2,1H3/t14-/m1/s1 |
| InChIKey | UGDGKGUYSKEJJL-CQSZACIVSA-N |
| XLogP | 3.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |