C19H22F3NO2S — CID 130254013
4-(2,4-difluorophenyl)-3-fluoro-N-heptan-4-ylbenzenesulfonamide (PubChem CID 130254013) has the molecular formula C19H22F3NO2S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-3-fluoro-N-heptan-4-ylbenzenesulfonamide.
| Compound Name | 4-(2,4-difluorophenyl)-3-fluoro-N-heptan-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 130254013 |
| Molecular Formula | C19H22F3NO2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-(2,4-difluorophenyl)-3-fluoro-N-heptan-4-ylbenzenesulfonamide |
| SMILES | CCCC(CCC)NS(=O)(=O)c1ccc(-c2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C19H22F3NO2S/c1-3-5-14(6-4-2)23-26(24,25)15-8-10-17(19(22)12-15)16-9-7-13(20)11-18(16)21/h7-12,14,23H,3-6H2,1-2H3 |
| InChIKey | TWLREXRNJYDBTI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |