C19H26N3O5S- — CID 129043040
1-cyclohexyloxycarbonyl-4-[3-methyl-4-(sulfinatoamino)benzoyl]piperazine (PubChem CID 129043040) has the molecular formula C19H26N3O5S- and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyl-4-[3-methyl-4-(sulfinatoamino)benzoyl]piperazine.
| Compound Name | 1-cyclohexyloxycarbonyl-4-[3-methyl-4-(sulfinatoamino)benzoyl]piperazine |
|---|---|
| PubChem CID | 129043040 |
| Molecular Formula | C19H26N3O5S- |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-cyclohexyloxycarbonyl-4-[3-methyl-4-(sulfinatoamino)benzoyl]piperazine |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)OC3CCCCC3)CC2)ccc1NS(=O)[O-] |
| InChI | InChI=1S/C19H27N3O5S/c1-14-13-15(7-8-17(14)20-28(25)26)18(23)21-9-11-22(12-10-21)19(24)27-16-5-3-2-4-6-16/h7-8,13,16,20H,2-6,9-12H2,1H3,(H,25,26)/p-1 |
| InChIKey | LALBPBWDEWLJOX-UHFFFAOYSA-M |
| XLogP | 2.43 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|