C17H23N3O6S — CID 129043115
1-[3-methyl-4-(sulfinoamino)benzoyl]-4-(oxolan-3-yloxycarbonyl)piperazine (PubChem CID 129043115) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is 1-[3-methyl-4-(sulfinoamino)benzoyl]-4-(oxolan-3-yloxycarbonyl)piperazine.
| Compound Name | 1-[3-methyl-4-(sulfinoamino)benzoyl]-4-(oxolan-3-yloxycarbonyl)piperazine |
|---|---|
| PubChem CID | 129043115 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-[3-methyl-4-(sulfinoamino)benzoyl]-4-(oxolan-3-yloxycarbonyl)piperazine |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)OC3CCOC3)CC2)ccc1NS(=O)O |
| InChI | InChI=1S/C17H23N3O6S/c1-12-10-13(2-3-15(12)18-27(23)24)16(21)19-5-7-20(8-6-19)17(22)26-14-4-9-25-11-14/h2-3,10,14,18H,4-9,11H2,1H3,(H,23,24) |
| InChIKey | IGKAOBOEDIGDTH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|