C19H19F3N4O4S — CID 129042897
1-[3-methyl-4-(sulfinoamino)benzoyl]-4-[5-(trifluoromethyl)pyridine-2-carbonyl]piperazine (PubChem CID 129042897) has the molecular formula C19H19F3N4O4S and a molecular weight of 456.45 g/mol. Its IUPAC name is 1-[3-methyl-4-(sulfinoamino)benzoyl]-4-[5-(trifluoromethyl)pyridine-2-carbonyl]piperazine.
| Compound Name | 1-[3-methyl-4-(sulfinoamino)benzoyl]-4-[5-(trifluoromethyl)pyridine-2-carbonyl]piperazine |
|---|---|
| PubChem CID | 129042897 |
| Molecular Formula | C19H19F3N4O4S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-[3-methyl-4-(sulfinoamino)benzoyl]-4-[5-(trifluoromethyl)pyridine-2-carbonyl]piperazine |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)c3ccc(C(F)(F)F)cn3)CC2)ccc1NS(=O)O |
| InChI | InChI=1S/C19H19F3N4O4S/c1-12-10-13(2-4-15(12)24-31(29)30)17(27)25-6-8-26(9-7-25)18(28)16-5-3-14(11-23-16)19(20,21)22/h2-5,10-11,24H,6-9H2,1H3,(H,29,30) |
| InChIKey | CYSQKTIBCMEERA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|