C19H18F3N4O3S+ — CID 162618394
[2-methyl-4-[4-[5-(trifluoromethyl)pyridine-2-carbonyl]piperazine-1-carbonyl]anilino]-oxosulfanium (PubChem CID 162618394) has the molecular formula C19H18F3N4O3S+ and a molecular weight of 439.44 g/mol. Its IUPAC name is [2-methyl-4-[4-[5-(trifluoromethyl)pyridine-2-carbonyl]piperazine-1-carbonyl]anilino]-oxosulfanium.
| Compound Name | [2-methyl-4-[4-[5-(trifluoromethyl)pyridine-2-carbonyl]piperazine-1-carbonyl]anilino]-oxosulfanium |
|---|---|
| PubChem CID | 162618394 |
| Molecular Formula | C19H18F3N4O3S+ |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [2-methyl-4-[4-[5-(trifluoromethyl)pyridine-2-carbonyl]piperazine-1-carbonyl]anilino]-oxosulfanium |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)c3ccc(C(F)(F)F)cn3)CC2)ccc1N[S+]=O |
| InChI | InChI=1S/C19H17F3N4O3S/c1-12-10-13(2-4-15(12)24-30-29)17(27)25-6-8-26(9-7-25)18(28)16-5-3-14(11-23-16)19(20,21)22/h2-5,10-11H,6-9H2,1H3/p+1 |
| InChIKey | FGDJNTLSNKCXKY-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|