C14H19N3O3 — CID 154786047
oxolan-3-yl 4-pyrimidin-2-ylpiperidine-1-carboxylate (PubChem CID 154786047) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is oxolan-3-yl 4-pyrimidin-2-ylpiperidine-1-carboxylate.
| Compound Name | oxolan-3-yl 4-pyrimidin-2-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 154786047 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | oxolan-3-yl 4-pyrimidin-2-ylpiperidine-1-carboxylate |
| SMILES | O=C(OC1CCOC1)N1CCC(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H19N3O3/c18-14(20-12-4-9-19-10-12)17-7-2-11(3-8-17)13-15-5-1-6-16-13/h1,5-6,11-12H,2-4,7-10H2 |
| InChIKey | SOOHMUOKTNVKSK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |