C20H22N6O4 — CID 67038202
oxolan-3-yl 4-[5-[(3-cyano-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 67038202) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is oxolan-3-yl 4-[5-[(3-cyano-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | oxolan-3-yl 4-[5-[(3-cyano-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67038202 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | oxolan-3-yl 4-[5-[(3-cyano-4-pyridinyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | N#Cc1cnccc1COc1cnc(N2CCN(C(=O)OC3CCOC3)CC2)nc1 |
| InChI | InChI=1S/C20H22N6O4/c21-9-16-10-22-3-1-15(16)13-29-18-11-23-19(24-12-18)25-4-6-26(7-5-25)20(27)30-17-2-8-28-14-17/h1,3,10-12,17H,2,4-8,13-14H2 |
| InChIKey | RAUPTGZJXGKYBU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 113.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |