C17H23N3O4 — CID 154770115
oxolan-3-yl 4-[(4-methylphenyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 154770115) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is oxolan-3-yl 4-[(4-methylphenyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | oxolan-3-yl 4-[(4-methylphenyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154770115 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | oxolan-3-yl 4-[(4-methylphenyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)N2CCN(C(=O)OC3CCOC3)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O4/c1-13-2-4-14(5-3-13)18-16(21)19-7-9-20(10-8-19)17(22)24-15-6-11-23-12-15/h2-5,15H,6-12H2,1H3,(H,18,21) |
| InChIKey | WGVPYJPSGQHJNM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |