C9H15NO — CID 129044509
(2R,3S,6R)-6-ethynyl-N,2-dimethyloxan-3-amine (PubChem CID 129044509) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2R,3S,6R)-6-ethynyl-N,2-dimethyloxan-3-amine.
| Compound Name | (2R,3S,6R)-6-ethynyl-N,2-dimethyloxan-3-amine |
|---|---|
| PubChem CID | 129044509 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2R,3S,6R)-6-ethynyl-N,2-dimethyloxan-3-amine |
| SMILES | C#C[C@H]1CC[C@H](NC)[C@@H](C)O1 |
| InChI | InChI=1S/C9H15NO/c1-4-8-5-6-9(10-3)7(2)11-8/h1,7-10H,5-6H2,2-3H3/t7-,8+,9+/m1/s1 |
| InChIKey | QWWCVRUZLFTJGI-VGMNWLOBSA-N |
| XLogP | 0.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|