C16H23F2N5S — CID 129044782
2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoyl-N-(thietan-3-yl)pyrimidin-4-amine (PubChem CID 129044782) has the molecular formula C16H23F2N5S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoyl-N-(thietan-3-yl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoyl-N-(thietan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 129044782 |
| Molecular Formula | C16H23F2N5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoyl-N-(thietan-3-yl)pyrimidin-4-amine |
| SMILES | [H]/N=C/c1c(NC2CSC2)nc(C(C)(C)C)nc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C16H23F2N5S/c1-15(2,3)14-21-12(20-10-7-24-8-10)11(6-19)13(22-14)23-5-4-16(17,18)9-23/h6,10,19H,4-5,7-9H2,1-3H3,(H,20,21,22)/b19-6+ |
| InChIKey | MEHLOJVWTGMLPK-KPSZGOFPSA-N |
| XLogP | 3.14 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|