C20H27F3N6O2S — CID 145421188
[2-[[amino-[5-amino-2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-4-yl]amino]methyl]phenyl]methanesulfonyl fluoride (PubChem CID 145421188) has the molecular formula C20H27F3N6O2S and a molecular weight of 472.54 g/mol. Its IUPAC name is [2-[[amino-[5-amino-2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-4-yl]amino]methyl]phenyl]methanesulfonyl fluoride.
| Compound Name | [2-[[amino-[5-amino-2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-4-yl]amino]methyl]phenyl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 145421188 |
| Molecular Formula | C20H27F3N6O2S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | [2-[[amino-[5-amino-2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-4-yl]amino]methyl]phenyl]methanesulfonyl fluoride |
| SMILES | CC(C)(C)c1nc(N(N)Cc2ccccc2CS(=O)(=O)F)c(N)c(N2CCC(F)(F)C2)n1 |
| InChI | InChI=1S/C20H27F3N6O2S/c1-19(2,3)18-26-16(28-9-8-20(21,22)12-28)15(24)17(27-18)29(25)10-13-6-4-5-7-14(13)11-32(23,30)31/h4-7H,8-12,24-25H2,1-3H3 |
| InChIKey | JVCFQIYGILVNEV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|