C18H20ClF5N6O — CID 144802580
4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-5-amine (PubChem CID 144802580) has the molecular formula C18H20ClF5N6O and a molecular weight of 466.84 g/mol. Its IUPAC name is 4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-5-amine.
| Compound Name | 4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-5-amine |
|---|---|
| PubChem CID | 144802580 |
| Molecular Formula | C18H20ClF5N6O |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-5-amine |
| SMILES | CC(Oc1nc(N(N)Cc2ccccc2Cl)c(N)c(N2CCC(F)(F)C2)n1)C(F)(F)F |
| InChI | InChI=1S/C18H20ClF5N6O/c1-10(18(22,23)24)31-16-27-14(29-7-6-17(20,21)9-29)13(25)15(28-16)30(26)8-11-4-2-3-5-12(11)19/h2-5,10H,6-9,25-26H2,1H3 |
| InChIKey | SAOVPVNUHQSMHJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|