C23H25ClF2N6S2 — CID 145421164
4-[amino-[(2-chlorophenyl)methyl]amino]-2-[difluoro(phenyl)methyl]-6-[3-(methyldisulfanyl)pyrrolidin-1-yl]pyrimidin-5-amine (PubChem CID 145421164) has the molecular formula C23H25ClF2N6S2 and a molecular weight of 523.08 g/mol. Its IUPAC name is 4-[amino-[(2-chlorophenyl)methyl]amino]-2-[difluoro(phenyl)methyl]-6-[3-(methyldisulfanyl)pyrrolidin-1-yl]pyrimidin-5-amine.
| Compound Name | 4-[amino-[(2-chlorophenyl)methyl]amino]-2-[difluoro(phenyl)methyl]-6-[3-(methyldisulfanyl)pyrrolidin-1-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 145421164 |
| Molecular Formula | C23H25ClF2N6S2 |
| Molecular Weight | 523.08 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 4-[amino-[(2-chlorophenyl)methyl]amino]-2-[difluoro(phenyl)methyl]-6-[3-(methyldisulfanyl)pyrrolidin-1-yl]pyrimidin-5-amine |
| SMILES | CSSC1CCN(c2nc(C(F)(F)c3ccccc3)nc(N(N)Cc3ccccc3Cl)c2N)C1 |
| InChI | InChI=1S/C23H25ClF2N6S2/c1-33-34-17-11-12-31(14-17)20-19(27)21(32(28)13-15-7-5-6-10-18(15)24)30-22(29-20)23(25,26)16-8-3-2-4-9-16/h2-10,17H,11-14,27-28H2,1H3 |
| InChIKey | QWCOBTXZRWPUEX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.08 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|