C18H24ClF2N6OS+ — CID 144802567
1-[5-amino-4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-1-ium-2-yl]sulfanylpropan-2-ol (PubChem CID 144802567) has the molecular formula C18H24ClF2N6OS+ and a molecular weight of 445.95 g/mol. Its IUPAC name is 1-[5-amino-4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-1-ium-2-yl]sulfanylpropan-2-ol.
| Compound Name | 1-[5-amino-4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-1-ium-2-yl]sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 144802567 |
| Molecular Formula | C18H24ClF2N6OS+ |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-[5-amino-4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)pyrimidin-1-ium-2-yl]sulfanylpropan-2-ol |
| SMILES | CC(O)CSc1nc(N(N)Cc2ccccc2Cl)c(N)c(N2CCC(F)(F)C2)[nH+]1 |
| InChI | InChI=1S/C18H23ClF2N6OS/c1-11(28)9-29-17-24-15(26-7-6-18(20,21)10-26)14(22)16(25-17)27(23)8-12-4-2-3-5-13(12)19/h2-5,11,28H,6-10,22-23H2,1H3/p+1 |
| InChIKey | HEMLWOSGWWSQDQ-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|