C19H24ClN7 — CID 137382596
4-[amino-[(2-chlorophenyl)methyl]amino]-2-tert-butyl-6-(2-methylpyrazol-3-yl)pyrimidin-5-amine (PubChem CID 137382596) has the molecular formula C19H24ClN7 and a molecular weight of 385.90 g/mol. Its IUPAC name is 4-[amino-[(2-chlorophenyl)methyl]amino]-2-tert-butyl-6-(2-methylpyrazol-3-yl)pyrimidin-5-amine.
| Compound Name | 4-[amino-[(2-chlorophenyl)methyl]amino]-2-tert-butyl-6-(2-methylpyrazol-3-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 137382596 |
| Molecular Formula | C19H24ClN7 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[amino-[(2-chlorophenyl)methyl]amino]-2-tert-butyl-6-(2-methylpyrazol-3-yl)pyrimidin-5-amine |
| SMILES | Cn1nccc1-c1nc(C(C)(C)C)nc(N(N)Cc2ccccc2Cl)c1N |
| InChI | InChI=1S/C19H24ClN7/c1-19(2,3)18-24-16(14-9-10-23-26(14)4)15(21)17(25-18)27(22)11-12-7-5-6-8-13(12)20/h5-10H,11,21-22H2,1-4H3 |
| InChIKey | BIJTVACMTBTHKT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|