C18H23ClF2N6O2S — CID 144802519
4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-propan-2-ylsulfonylpyrimidin-5-amine (PubChem CID 144802519) has the molecular formula C18H23ClF2N6O2S and a molecular weight of 460.94 g/mol. Its IUPAC name is 4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-propan-2-ylsulfonylpyrimidin-5-amine.
| Compound Name | 4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-propan-2-ylsulfonylpyrimidin-5-amine |
|---|---|
| PubChem CID | 144802519 |
| Molecular Formula | C18H23ClF2N6O2S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-propan-2-ylsulfonylpyrimidin-5-amine |
| SMILES | CC(C)S(=O)(=O)c1nc(N(N)Cc2ccccc2Cl)c(N)c(N2CCC(F)(F)C2)n1 |
| InChI | InChI=1S/C18H23ClF2N6O2S/c1-11(2)30(28,29)17-24-15(26-8-7-18(20,21)10-26)14(22)16(25-17)27(23)9-12-5-3-4-6-13(12)19/h3-6,11H,7-10,22-23H2,1-2H3 |
| InChIKey | XSXVGXHPFVNZMN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|