C20H27ClF2N7O+ — CID 163434925
[4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-[(3-methyloxetan-3-yl)amino]pyrimidin-5-yl]-methylazanium (PubChem CID 163434925) has the molecular formula C20H27ClF2N7O+ and a molecular weight of 454.93 g/mol. Its IUPAC name is [4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-[(3-methyloxetan-3-yl)amino]pyrimidin-5-yl]-methylazanium.
| Compound Name | [4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-[(3-methyloxetan-3-yl)amino]pyrimidin-5-yl]-methylazanium |
|---|---|
| PubChem CID | 163434925 |
| Molecular Formula | C20H27ClF2N7O+ |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [4-[amino-[(2-chlorophenyl)methyl]amino]-6-(3,3-difluoropyrrolidin-1-yl)-2-[(3-methyloxetan-3-yl)amino]pyrimidin-5-yl]-methylazanium |
| SMILES | C[NH2+]c1c(N(N)Cc2ccccc2Cl)nc(NC2(C)COC2)nc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C20H26ClF2N7O/c1-19(11-31-12-19)28-18-26-16(29-8-7-20(22,23)10-29)15(25-2)17(27-18)30(24)9-13-5-3-4-6-14(13)21/h3-6,25H,7-12,24H2,1-2H3,(H,26,27,28)/p+1 |
| InChIKey | ATQPUZZOVBTFSH-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|