C21H30ClN7O — CID 144802586
4-[(2-chlorophenyl)methyl-(methylamino)amino]-2-morpholin-4-yl-6-piperidin-1-ylpyrimidin-5-amine (PubChem CID 144802586) has the molecular formula C21H30ClN7O and a molecular weight of 431.97 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl-(methylamino)amino]-2-morpholin-4-yl-6-piperidin-1-ylpyrimidin-5-amine.
| Compound Name | 4-[(2-chlorophenyl)methyl-(methylamino)amino]-2-morpholin-4-yl-6-piperidin-1-ylpyrimidin-5-amine |
|---|---|
| PubChem CID | 144802586 |
| Molecular Formula | C21H30ClN7O |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl-(methylamino)amino]-2-morpholin-4-yl-6-piperidin-1-ylpyrimidin-5-amine |
| SMILES | CNN(Cc1ccccc1Cl)c1nc(N2CCOCC2)nc(N2CCCCC2)c1N |
| InChI | InChI=1S/C21H30ClN7O/c1-24-29(15-16-7-3-4-8-17(16)22)20-18(23)19(27-9-5-2-6-10-27)25-21(26-20)28-11-13-30-14-12-28/h3-4,7-8,24H,2,5-6,9-15,23H2,1H3 |
| InChIKey | ZUKVJONLYBOGCB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|