C19H21F3N4O3S — CID 129045742
(3S)-5-(2-cyclopropylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)oxan-3-amine (PubChem CID 129045742) has the molecular formula C19H21F3N4O3S and a molecular weight of 442.46 g/mol. Its IUPAC name is (3S)-5-(2-cyclopropylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)oxan-3-amine.
| Compound Name | (3S)-5-(2-cyclopropylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 129045742 |
| Molecular Formula | C19H21F3N4O3S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (3S)-5-(2-cyclopropylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)oxan-3-amine |
| SMILES | N[C@H]1CC(N2Cc3cn(S(=O)(=O)C4CC4)nc3C2)COC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H21F3N4O3S/c20-14-5-16(22)15(21)4-13(14)19-17(23)3-11(9-29-19)25-6-10-7-26(24-18(10)8-25)30(27,28)12-1-2-12/h4-5,7,11-12,17,19H,1-3,6,8-9,23H2/t11?,17-,19?/m0/s1 |
| InChIKey | AWJGMPKHYSURMN-WILKRBQNSA-N |
| XLogP | 1.81 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|