C21H21ClN6O3 — CID 129052017
1-[[4-(2-aminoethylamino)-3-nitrophenyl]methyl]-5-(1H-indazol-6-yl)pyridin-2-one;hydrochloride (PubChem CID 129052017) has the molecular formula C21H21ClN6O3 and a molecular weight of 440.89 g/mol. Its IUPAC name is 1-[[4-(2-aminoethylamino)-3-nitrophenyl]methyl]-5-(1H-indazol-6-yl)pyridin-2-one;hydrochloride.
| Compound Name | 1-[[4-(2-aminoethylamino)-3-nitrophenyl]methyl]-5-(1H-indazol-6-yl)pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 129052017 |
| Molecular Formula | C21H21ClN6O3 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-[[4-(2-aminoethylamino)-3-nitrophenyl]methyl]-5-(1H-indazol-6-yl)pyridin-2-one;hydrochloride |
| SMILES | Cl.NCCNc1ccc(Cn2cc(-c3ccc4cn[nH]c4c3)ccc2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20N6O3.ClH/c22-7-8-23-18-5-1-14(9-20(18)27(29)30)12-26-13-17(4-6-21(26)28)15-2-3-16-11-24-25-19(16)10-15;/h1-6,9-11,13,23H,7-8,12,22H2,(H,24,25);1H |
| InChIKey | XYYYQDUPBQIALQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|