C24H24N4O3 — CID 140931435
tert-butyl N-[3-[[5-(1H-indazol-6-yl)-2-oxo-1-pyridinyl]methyl]phenyl]carbamate (PubChem CID 140931435) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-(1H-indazol-6-yl)-2-oxo-1-pyridinyl]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-(1H-indazol-6-yl)-2-oxo-1-pyridinyl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 140931435 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | tert-butyl N-[3-[[5-(1H-indazol-6-yl)-2-oxo-1-pyridinyl]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Cn2cc(-c3ccc4cn[nH]c4c3)ccc2=O)c1 |
| InChI | InChI=1S/C24H24N4O3/c1-24(2,3)31-23(30)26-20-6-4-5-16(11-20)14-28-15-19(9-10-22(28)29)17-7-8-18-13-25-27-21(18)12-17/h4-13,15H,14H2,1-3H3,(H,25,27)(H,26,30) |
| InChIKey | LHUXRKPZNGNPTI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |