C12H14BrN3O2S — CID 129053936
6-bromo-3-(2-methylpyrrolidin-1-yl)sulfonylimidazo[1,2-a]pyridine (PubChem CID 129053936) has the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. Its IUPAC name is 6-bromo-3-(2-methylpyrrolidin-1-yl)sulfonylimidazo[1,2-a]pyridine.
| Compound Name | 6-bromo-3-(2-methylpyrrolidin-1-yl)sulfonylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 129053936 |
| Molecular Formula | C12H14BrN3O2S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 6-bromo-3-(2-methylpyrrolidin-1-yl)sulfonylimidazo[1,2-a]pyridine |
| SMILES | CC1CCCN1S(=O)(=O)c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C12H14BrN3O2S/c1-9-3-2-6-16(9)19(17,18)12-7-14-11-5-4-10(13)8-15(11)12/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | JBGCOQPODCGRMY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |