C16H21Cl2NO2 — CID 12905454
2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]-1-prop-2-enylpyrrolidine (PubChem CID 12905454) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.25 g/mol. Its IUPAC name is 2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]-1-prop-2-enylpyrrolidine.
| Compound Name | 2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]-1-prop-2-enylpyrrolidine |
|---|---|
| PubChem CID | 12905454 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[2-(3,5-dichloro-2-methoxyphenoxy)ethyl]-1-prop-2-enylpyrrolidine |
| SMILES | C=CCN1CCCC1CCOc1cc(Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C16H21Cl2NO2/c1-3-7-19-8-4-5-13(19)6-9-21-15-11-12(17)10-14(18)16(15)20-2/h3,10-11,13H,1,4-9H2,2H3 |
| InChIKey | YNNUHKCTTJPHOB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|