C19H21NO5 — CID 129054971
prop-2-enyl (2S,4S)-4-ethynyl-2-[(4-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate (PubChem CID 129054971) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-4-ethynyl-2-[(4-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-4-ethynyl-2-[(4-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 129054971 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | prop-2-enyl (2S,4S)-4-ethynyl-2-[(4-methoxycarbonylphenoxy)methyl]pyrrolidine-1-carboxylate |
| SMILES | C#C[C@@H]1C[C@@H](COc2ccc(C(=O)OC)cc2)N(C(=O)OCC=C)C1 |
| InChI | InChI=1S/C19H21NO5/c1-4-10-24-19(22)20-12-14(5-2)11-16(20)13-25-17-8-6-15(7-9-17)18(21)23-3/h2,4,6-9,14,16H,1,10-13H2,3H3/t14-,16+/m1/s1 |
| InChIKey | FFDHKIPQNZTPCM-ZBFHGGJFSA-N |
| XLogP | 2.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|