C21H22Cl2N2O3 — CID 129057617
(6R)-1'-[(2,6-dichlorophenyl)methyl]-N-hydroxy-2'-oxospiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide (PubChem CID 129057617) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is (6R)-1'-[(2,6-dichlorophenyl)methyl]-N-hydroxy-2'-oxospiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide.
| Compound Name | (6R)-1'-[(2,6-dichlorophenyl)methyl]-N-hydroxy-2'-oxospiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 129057617 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (6R)-1'-[(2,6-dichlorophenyl)methyl]-N-hydroxy-2'-oxospiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide |
| SMILES | O=C(NO)C1=CC2CC[C@]3(CCN(Cc4c(Cl)cccc4Cl)C3=O)CC2C=C1 |
| InChI | InChI=1S/C21H22Cl2N2O3/c22-17-2-1-3-18(23)16(17)12-25-9-8-21(20(25)27)7-6-13-10-14(19(26)24-28)4-5-15(13)11-21/h1-5,10,13,15,28H,6-9,11-12H2,(H,24,26)/t13?,15?,21-/m0/s1 |
| InChIKey | QIGZURNRRPFQKV-CQGXBLDFSA-N |
| XLogP | 4.13 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|