C19H20ClN3O3 — CID 129057588
(6R)-1'-(5-chloro-3-pyridinyl)-N-hydroxy-2'-oxospiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide (PubChem CID 129057588) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is (6R)-1'-(5-chloro-3-pyridinyl)-N-hydroxy-2'-oxospiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide.
| Compound Name | (6R)-1'-(5-chloro-3-pyridinyl)-N-hydroxy-2'-oxospiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 129057588 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (6R)-1'-(5-chloro-3-pyridinyl)-N-hydroxy-2'-oxospiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide |
| SMILES | O=C(NO)C1=CC2CC[C@]3(CCN(c4cncc(Cl)c4)C3=O)CC2C=C1 |
| InChI | InChI=1S/C19H20ClN3O3/c20-15-8-16(11-21-10-15)23-6-5-19(18(23)25)4-3-12-7-13(17(24)22-26)1-2-14(12)9-19/h1-2,7-8,10-12,14,26H,3-6,9H2,(H,22,24)/t12?,14?,19-/m0/s1 |
| InChIKey | QLRVQVSWKRCTNC-JSORRYRYSA-N |
| XLogP | 2.88 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|