C27H34N6O2 — CID 129058658
[4-[2-(aminodiazenyl)-4-(piperidine-1-carbonyl)-2,3-dihydro-1H-1-benzazepin-8-yl]cyclohexa-1,3-dien-1-yl]-pyrrolidin-1-ylmethanone (PubChem CID 129058658) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is [4-[2-(aminodiazenyl)-4-(piperidine-1-carbonyl)-2,3-dihydro-1H-1-benzazepin-8-yl]cyclohexa-1,3-dien-1-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[2-(aminodiazenyl)-4-(piperidine-1-carbonyl)-2,3-dihydro-1H-1-benzazepin-8-yl]cyclohexa-1,3-dien-1-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 129058658 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | [4-[2-(aminodiazenyl)-4-(piperidine-1-carbonyl)-2,3-dihydro-1H-1-benzazepin-8-yl]cyclohexa-1,3-dien-1-yl]-pyrrolidin-1-ylmethanone |
| SMILES | NN=NC1CC(C(=O)N2CCCCC2)=Cc2ccc(C3=CC=C(C(=O)N4CCCC4)CC3)cc2N1 |
| InChI | InChI=1S/C27H34N6O2/c28-31-30-25-18-23(27(35)33-12-2-1-3-13-33)16-22-11-10-21(17-24(22)29-25)19-6-8-20(9-7-19)26(34)32-14-4-5-15-32/h6,8,10-11,16-17,25,29H,1-5,7,9,12-15,18H2,(H2,28,30) |
| InChIKey | QJNPLQAPBLSSHR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|