C26H30N6O2 — CID 129058392
[2-(aminodiazenyl)-8-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1H-1-benzazepin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 129058392) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is [2-(aminodiazenyl)-8-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1H-1-benzazepin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-(aminodiazenyl)-8-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1H-1-benzazepin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 129058392 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | [2-(aminodiazenyl)-8-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1H-1-benzazepin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | NN=NC1CC(C(=O)N2CCCC2)=Cc2ccc(-c3ccc(C(=O)N4CCCC4)cc3)cc2N1 |
| InChI | InChI=1S/C26H30N6O2/c27-30-29-24-17-22(26(34)32-13-3-4-14-32)15-21-10-9-20(16-23(21)28-24)18-5-7-19(8-6-18)25(33)31-11-1-2-12-31/h5-10,15-16,24,28H,1-4,11-14,17H2,(H2,27,29) |
| InChIKey | WOKPWSQQAVICIA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|