C30H40N6O2 — CID 129058389
2-(aminodiazenyl)-N,N-bis(2-methylpropyl)-8-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1H-1-benzazepine-4-carboxamide (PubChem CID 129058389) has the molecular formula C30H40N6O2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-(aminodiazenyl)-N,N-bis(2-methylpropyl)-8-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1H-1-benzazepine-4-carboxamide.
| Compound Name | 2-(aminodiazenyl)-N,N-bis(2-methylpropyl)-8-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 129058389 |
| Molecular Formula | C30H40N6O2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | 2-(aminodiazenyl)-N,N-bis(2-methylpropyl)-8-[4-(pyrrolidine-1-carbonyl)phenyl]-2,3-dihydro-1H-1-benzazepine-4-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C1=Cc2ccc(-c3ccc(C(=O)N4CCCC4)cc3)cc2NC(N=NN)C1 |
| InChI | InChI=1S/C30H40N6O2/c1-20(2)18-36(19-21(3)4)30(38)26-15-25-12-11-24(16-27(25)32-28(17-26)33-34-31)22-7-9-23(10-8-22)29(37)35-13-5-6-14-35/h7-12,15-16,20-21,28,32H,5-6,13-14,17-19H2,1-4H3,(H2,31,33) |
| InChIKey | ZXFFGRSGTHARLR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|