About 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine
2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine (PubChem CID 129059438) has the molecular formula C12H24IN
and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine.
Molecular Properties
| Compound Name | 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine |
| PubChem CID | 129059438 |
| Molecular Formula | C12H24IN |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine |
| SMILES | C=C(CCC(NC)C(C)I)C(C)CC |
| InChI | InChI=1S/C12H24IN/c1-6-9(2)10(3)7-8-12(14-5)11(4)13/h9,11-12,14H,3,6-8H2,1-2,4-5H3 |
| InChIKey | XDDCGUQBUBFQTN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine?
The IUPAC name of 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine (CID 129059438) is 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine.
What is the SMILES notation for 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine?
The canonical SMILES for 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine is C=C(CCC(NC)C(C)I)C(C)CC.
What is the InChIKey of 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine?
The InChIKey is XDDCGUQBUBFQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24IN/c1-6-9(2)10(3)7-8-12(14-5)11(4)13/h9,11-12,14H,3,6-8H2,1-2,4-5H3.
What are the key properties of 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine?
2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine has a molecular weight of 309.24 g/mol, XLogP of 3.78, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine is sourced from PubChem (CID 129059438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).