C12H24IN — CID 129059438
2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine (PubChem CID 129059438) has the molecular formula C12H24IN and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine.
| Compound Name | 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine |
|---|---|
| PubChem CID | 129059438 |
| Molecular Formula | C12H24IN |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-iodo-N,7-dimethyl-6-methylidenenonan-3-amine |
| SMILES | C=C(CCC(NC)C(C)I)C(C)CC |
| InChI | InChI=1S/C12H24IN/c1-6-9(2)10(3)7-8-12(14-5)11(4)13/h9,11-12,14H,3,6-8H2,1-2,4-5H3 |
| InChIKey | XDDCGUQBUBFQTN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|