C18H24ClFN2 — CID 129059689
4-(3-chloro-2-fluorophenyl)-2-(2-ethyl-2-methylbutyl)pyrrolidine-3-carbonitrile (PubChem CID 129059689) has the molecular formula C18H24ClFN2 and a molecular weight of 322.86 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)-2-(2-ethyl-2-methylbutyl)pyrrolidine-3-carbonitrile.
| Compound Name | 4-(3-chloro-2-fluorophenyl)-2-(2-ethyl-2-methylbutyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 129059689 |
| Molecular Formula | C18H24ClFN2 |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)-2-(2-ethyl-2-methylbutyl)pyrrolidine-3-carbonitrile |
| SMILES | CCC(C)(CC)CC1NCC(c2cccc(Cl)c2F)C1C#N |
| InChI | InChI=1S/C18H24ClFN2/c1-4-18(3,5-2)9-16-13(10-21)14(11-22-16)12-7-6-8-15(19)17(12)20/h6-8,13-14,16,22H,4-5,9,11H2,1-3H3 |
| InChIKey | PGGVYHGTJNSLFT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |