C16H22ClFN2 — CID 129059432
4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylbut-3-enyl)pyrrolidin-3-amine (PubChem CID 129059432) has the molecular formula C16H22ClFN2 and a molecular weight of 296.82 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylbut-3-enyl)pyrrolidin-3-amine.
| Compound Name | 4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylbut-3-enyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 129059432 |
| Molecular Formula | C16H22ClFN2 |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)-2-(2,2-dimethylbut-3-enyl)pyrrolidin-3-amine |
| SMILES | C=CC(C)(C)CC1NCC(c2cccc(Cl)c2F)C1N |
| InChI | InChI=1S/C16H22ClFN2/c1-4-16(2,3)8-13-15(19)11(9-20-13)10-6-5-7-12(17)14(10)18/h4-7,11,13,15,20H,1,8-9,19H2,2-3H3 |
| InChIKey | VUKGMKZKJFORLC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|