C21H22ClFN2 — CID 129059448
4-(3-chloro-2-fluorophenyl)-2-(2-methyl-2-phenylpropyl)pyrrolidine-3-carbonitrile (PubChem CID 129059448) has the molecular formula C21H22ClFN2 and a molecular weight of 356.87 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)-2-(2-methyl-2-phenylpropyl)pyrrolidine-3-carbonitrile.
| Compound Name | 4-(3-chloro-2-fluorophenyl)-2-(2-methyl-2-phenylpropyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 129059448 |
| Molecular Formula | C21H22ClFN2 |
| Molecular Weight | 356.87 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)-2-(2-methyl-2-phenylpropyl)pyrrolidine-3-carbonitrile |
| SMILES | CC(C)(CC1NCC(c2cccc(Cl)c2F)C1C#N)c1ccccc1 |
| InChI | InChI=1S/C21H22ClFN2/c1-21(2,14-7-4-3-5-8-14)11-19-16(12-24)17(13-25-19)15-9-6-10-18(22)20(15)23/h3-10,16-17,19,25H,11,13H2,1-2H3 |
| InChIKey | LILDNXHPMJQFIU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |