C9H17F2NO2 — CID 129061110
2-amino-4-(difluoromethyl)-4-methylheptanoic acid (PubChem CID 129061110) has the molecular formula C9H17F2NO2 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-amino-4-(difluoromethyl)-4-methylheptanoic acid.
| Compound Name | 2-amino-4-(difluoromethyl)-4-methylheptanoic acid |
|---|---|
| PubChem CID | 129061110 |
| Molecular Formula | C9H17F2NO2 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-amino-4-(difluoromethyl)-4-methylheptanoic acid |
| SMILES | CCCC(C)(CC(N)C(=O)O)C(F)F |
| InChI | InChI=1S/C9H17F2NO2/c1-3-4-9(2,8(10)11)5-6(12)7(13)14/h6,8H,3-5,12H2,1-2H3,(H,13,14) |
| InChIKey | DIONHXZYVDIAPS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |