C10H19F2NO — CID 161024309
(3S,5R)-3-amino-5-(difluoromethyl)-5-methyloctan-2-one (PubChem CID 161024309) has the molecular formula C10H19F2NO and a molecular weight of 207.26 g/mol. Its IUPAC name is (3S,5R)-3-amino-5-(difluoromethyl)-5-methyloctan-2-one.
| Compound Name | (3S,5R)-3-amino-5-(difluoromethyl)-5-methyloctan-2-one |
|---|---|
| PubChem CID | 161024309 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (3S,5R)-3-amino-5-(difluoromethyl)-5-methyloctan-2-one |
| SMILES | CCC[C@](C)(C[C@H](N)C(C)=O)C(F)F |
| InChI | InChI=1S/C10H19F2NO/c1-4-5-10(3,9(11)12)6-8(13)7(2)14/h8-9H,4-6,13H2,1-3H3/t8-,10+/m0/s1 |
| InChIKey | FAPBKDJXXIMGHQ-WCBMZHEXSA-N |
| XLogP | 2.36 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |