C34H36N2O2 — CID 129064652
N,4-bis(4-methylphenyl)-2-oxo-6-(4-pentylphenyl)-5-[(E)-prop-1-enyl]-1H-pyridine-3-carboxamide (PubChem CID 129064652) has the molecular formula C34H36N2O2 and a molecular weight of 504.67 g/mol. Its IUPAC name is N,4-bis(4-methylphenyl)-2-oxo-6-(4-pentylphenyl)-5-[(E)-prop-1-enyl]-1H-pyridine-3-carboxamide.
| Compound Name | N,4-bis(4-methylphenyl)-2-oxo-6-(4-pentylphenyl)-5-[(E)-prop-1-enyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129064652 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | N,4-bis(4-methylphenyl)-2-oxo-6-(4-pentylphenyl)-5-[(E)-prop-1-enyl]-1H-pyridine-3-carboxamide |
| SMILES | C/C=C/c1c(-c2ccc(CCCCC)cc2)[nH]c(=O)c(C(=O)Nc2ccc(C)cc2)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C34H36N2O2/c1-5-7-8-10-25-15-19-27(20-16-25)32-29(9-6-2)30(26-17-11-23(3)12-18-26)31(34(38)36-32)33(37)35-28-21-13-24(4)14-22-28/h6,9,11-22H,5,7-8,10H2,1-4H3,(H,35,37)(H,36,38)/b9-6+ |
| InChIKey | XTMRXMMOTJKHCG-RMKNXTFCSA-N |
| XLogP | 8.34 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|