C17H32FNO — CID 129068031
1-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-pentyloctan-1-one (PubChem CID 129068031) has the molecular formula C17H32FNO and a molecular weight of 285.45 g/mol. Its IUPAC name is 1-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-pentyloctan-1-one.
| Compound Name | 1-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-pentyloctan-1-one |
|---|---|
| PubChem CID | 129068031 |
| Molecular Formula | C17H32FNO |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 1-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-pentyloctan-1-one |
| SMILES | CCCCCCC(CCCCC)C(=O)[C@@H]1C[C@@H](F)CN1 |
| InChI | InChI=1S/C17H32FNO/c1-3-5-7-9-11-14(10-8-6-4-2)17(20)16-12-15(18)13-19-16/h14-16,19H,3-13H2,1-2H3/t14?,15-,16+/m1/s1 |
| InChIKey | QEHZRRPIFHDLGO-JAIYHHTPSA-N |
| XLogP | 4.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|