C23H16BrClFNO4 — CID 129068943
[1-[[2-[(3-bromo-4-fluorophenyl)methoxy]-5-chlorophenyl]methyl]indol-4-yl] hydrogen carbonate (PubChem CID 129068943) has the molecular formula C23H16BrClFNO4 and a molecular weight of 504.74 g/mol. Its IUPAC name is [1-[[2-[(3-bromo-4-fluorophenyl)methoxy]-5-chlorophenyl]methyl]indol-4-yl] hydrogen carbonate.
| Compound Name | [1-[[2-[(3-bromo-4-fluorophenyl)methoxy]-5-chlorophenyl]methyl]indol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 129068943 |
| Molecular Formula | C23H16BrClFNO4 |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | [1-[[2-[(3-bromo-4-fluorophenyl)methoxy]-5-chlorophenyl]methyl]indol-4-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cccc2c1ccn2Cc1cc(Cl)ccc1OCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C23H16BrClFNO4/c24-18-10-14(4-6-19(18)26)13-30-21-7-5-16(25)11-15(21)12-27-9-8-17-20(27)2-1-3-22(17)31-23(28)29/h1-11H,12-13H2,(H,28,29) |
| InChIKey | ZFQGMQUYDWZZKE-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|