C22H16Cl2N2O4 — CID 129069068
[1-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]indazol-4-yl] hydrogen carbonate (PubChem CID 129069068) has the molecular formula C22H16Cl2N2O4 and a molecular weight of 443.29 g/mol. Its IUPAC name is [1-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]indazol-4-yl] hydrogen carbonate.
| Compound Name | [1-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]indazol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 129069068 |
| Molecular Formula | C22H16Cl2N2O4 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | [1-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]indazol-4-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cccc2c1cnn2Cc1cc(Cl)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H16Cl2N2O4/c23-16-8-9-20(29-13-14-4-1-2-5-18(14)24)15(10-16)12-26-19-6-3-7-21(30-22(27)28)17(19)11-25-26/h1-11H,12-13H2,(H,27,28) |
| InChIKey | FRVUBGVBEYGHIL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|