C22H16ClFN2O3 — CID 89444227
1-[[2-[(2-chlorophenyl)methoxy]-5-fluorophenyl]methyl]indazole-4-carboxylic acid (PubChem CID 89444227) has the molecular formula C22H16ClFN2O3 and a molecular weight of 410.83 g/mol. Its IUPAC name is 1-[[2-[(2-chlorophenyl)methoxy]-5-fluorophenyl]methyl]indazole-4-carboxylic acid.
| Compound Name | 1-[[2-[(2-chlorophenyl)methoxy]-5-fluorophenyl]methyl]indazole-4-carboxylic acid |
|---|---|
| PubChem CID | 89444227 |
| Molecular Formula | C22H16ClFN2O3 |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 1-[[2-[(2-chlorophenyl)methoxy]-5-fluorophenyl]methyl]indazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1cnn2Cc1cc(F)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H16ClFN2O3/c23-19-6-2-1-4-14(19)13-29-21-9-8-16(24)10-15(21)12-26-20-7-3-5-17(22(27)28)18(20)11-25-26/h1-11H,12-13H2,(H,27,28) |
| InChIKey | PCIFROOINYDSCV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |