C22H15Cl2N2NaO3 — CID 129068855
sodium 1-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]indazole-4-carboxylate (PubChem CID 129068855) has the molecular formula C22H15Cl2N2NaO3 and a molecular weight of 449.27 g/mol. Its IUPAC name is sodium 1-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]indazole-4-carboxylate.
| Compound Name | sodium 1-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]indazole-4-carboxylate |
|---|---|
| PubChem CID | 129068855 |
| Molecular Formula | C22H15Cl2N2NaO3 |
| Molecular Weight | 449.27 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | sodium 1-[[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]methyl]indazole-4-carboxylate |
| SMILES | O=C([O-])c1cccc2c1cnn2Cc1cc(Cl)ccc1OCc1ccccc1Cl.[Na+] |
| InChI | InChI=1S/C22H16Cl2N2O3.Na/c23-16-8-9-21(29-13-14-4-1-2-6-19(14)24)15(10-16)12-26-20-7-3-5-17(22(27)28)18(20)11-25-26;/h1-11H,12-13H2,(H,27,28);/q;+1/p-1 |
| InChIKey | FPSBTVBPUUBINZ-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |