C20H20ClNO5 — CID 129068981
[4-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]-2,3-dihydro-1,4-benzoxazin-8-yl] hydrogen carbonate (PubChem CID 129068981) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is [4-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]-2,3-dihydro-1,4-benzoxazin-8-yl] hydrogen carbonate.
| Compound Name | [4-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]-2,3-dihydro-1,4-benzoxazin-8-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 129068981 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | [4-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methyl]-2,3-dihydro-1,4-benzoxazin-8-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cccc2c1OCCN2Cc1cc(Cl)ccc1OCC1CC1 |
| InChI | InChI=1S/C20H20ClNO5/c21-15-6-7-17(26-12-13-4-5-13)14(10-15)11-22-8-9-25-19-16(22)2-1-3-18(19)27-20(23)24/h1-3,6-7,10,13H,4-5,8-9,11-12H2,(H,23,24) |
| InChIKey | RZJZOWOJUHSYQS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|