C10H6BrF5O5S — CID 129070568
2-(4-bromobenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 129070568) has the molecular formula C10H6BrF5O5S and a molecular weight of 413.11 g/mol. Its IUPAC name is 2-(4-bromobenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-(4-bromobenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070568 |
| Molecular Formula | C10H6BrF5O5S |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 411.90 |
| IUPAC Name | 2-(4-bromobenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H6BrF5O5S/c11-6-3-1-5(2-4-6)7(17)21-8(9(12,13)14)10(15,16)22(18,19)20/h1-4,8H,(H,18,19,20) |
| InChIKey | OYZFHOYBOAERBN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|