C17H28O3 — CID 129070740
2-[5-(2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-methylprop-2-enoate (PubChem CID 129070740) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[5-(2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-(2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129070740 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[5-(2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC1CC2CC1CC2CC(C)(C)O |
| InChI | InChI=1S/C17H28O3/c1-11(2)16(18)20-6-5-12-7-14-8-13(12)9-15(14)10-17(3,4)19/h12-15,19H,1,5-10H2,2-4H3 |
| InChIKey | VGFXTLAKBXJXFJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|