C9H7ClN4 — CID 12907200
5-chloro-6-propylpyrazine-2,3-dicarbonitrile (PubChem CID 12907200) has the molecular formula C9H7ClN4 and a molecular weight of 206.64 g/mol. Its IUPAC name is 5-chloro-6-propylpyrazine-2,3-dicarbonitrile.
| Compound Name | 5-chloro-6-propylpyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 12907200 |
| Molecular Formula | C9H7ClN4 |
| Molecular Weight | 206.64 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 5-chloro-6-propylpyrazine-2,3-dicarbonitrile |
| SMILES | CCCc1nc(C#N)c(C#N)nc1Cl |
| InChI | InChI=1S/C9H7ClN4/c1-2-3-6-9(10)14-8(5-12)7(4-11)13-6/h2-3H2,1H3 |
| InChIKey | IRNHUICHRWGEBD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.64 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |