C11H11ClN4 — CID 12907202
5-chloro-6-pentylpyrazine-2,3-dicarbonitrile (PubChem CID 12907202) has the molecular formula C11H11ClN4 and a molecular weight of 234.69 g/mol. Its IUPAC name is 5-chloro-6-pentylpyrazine-2,3-dicarbonitrile.
| Compound Name | 5-chloro-6-pentylpyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 12907202 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 5-chloro-6-pentylpyrazine-2,3-dicarbonitrile |
| SMILES | CCCCCc1nc(C#N)c(C#N)nc1Cl |
| InChI | InChI=1S/C11H11ClN4/c1-2-3-4-5-8-11(12)16-10(7-14)9(6-13)15-8/h2-5H2,1H3 |
| InChIKey | RGNRGDPCWPULRJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|